C17H28O3Si — CID 102285704
(5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-phenyloxolan-2-ol (PubChem CID 102285704) has the molecular formula C17H28O3Si and a molecular weight of 308.49 g/mol. Its IUPAC name is (5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-phenyloxolan-2-ol.
| Compound Name | (5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-phenyloxolan-2-ol |
|---|---|
| PubChem CID | 102285704 |
| Molecular Formula | C17H28O3Si |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | (5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-phenyloxolan-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@]1(c2ccccc2)CCC(O)O1 |
| InChI | InChI=1S/C17H28O3Si/c1-16(2,3)21(4,5)19-13-17(12-11-15(18)20-17)14-9-7-6-8-10-14/h6-10,15,18H,11-13H2,1-5H3/t15?,17-/m0/s1 |
| InChIKey | DFSPEYVJCPNMGC-LWKPJOBUSA-N |
| XLogP | 4.03 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|