C18H30O2Si — CID 101364464
tert-butyl-[[(2S,3R)-2-ethyl-3-methyl-3-phenyloxiran-2-yl]methoxy]-dimethylsilane (PubChem CID 101364464) has the molecular formula C18H30O2Si and a molecular weight of 306.52 g/mol. Its IUPAC name is tert-butyl-[[(2S,3R)-2-ethyl-3-methyl-3-phenyloxiran-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2S,3R)-2-ethyl-3-methyl-3-phenyloxiran-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 101364464 |
| Molecular Formula | C18H30O2Si |
| Molecular Weight | 306.52 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | tert-butyl-[[(2S,3R)-2-ethyl-3-methyl-3-phenyloxiran-2-yl]methoxy]-dimethylsilane |
| SMILES | CC[C@@]1(CO[Si](C)(C)C(C)(C)C)O[C@]1(C)c1ccccc1 |
| InChI | InChI=1S/C18H30O2Si/c1-8-18(14-19-21(6,7)16(2,3)4)17(5,20-18)15-12-10-9-11-13-15/h9-13H,8,14H2,1-7H3/t17-,18+/m1/s1 |
| InChIKey | PEVLUNHKGJQZMJ-MSOLQXFVSA-N |
| XLogP | 5.10 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.52 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|