C17H25NOSi — CID 11781176
cis-(1S,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-phenylcyclopropane-1-carbonitrile (PubChem CID 11781176) has the molecular formula C17H25NOSi and a molecular weight of 287.48 g/mol. Its IUPAC name is cis-(1S,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-phenylcyclopropane-1-carbonitrile.
| Compound Name | cis-(1S,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-phenylcyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 11781176 |
| Molecular Formula | C17H25NOSi |
| Molecular Weight | 287.48 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | cis-(1S,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-phenylcyclopropane-1-carbonitrile |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1C[C@@]1(C#N)c1ccccc1 |
| InChI | InChI=1S/C17H25NOSi/c1-16(2,3)20(4,5)19-12-15-11-17(15,13-18)14-9-7-6-8-10-14/h6-10,15H,11-12H2,1-5H3/t15-,17+/m0/s1 |
| InChIKey | CXLPSRIPAZMMFC-DOTOQJQBSA-N |
| XLogP | 4.49 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|