C19H30O2Si — CID 134944366
tert-butyl-[[(2S,5R)-3,5-dimethyl-5-phenyl-2H-furan-2-yl]methoxy]-dimethylsilane (PubChem CID 134944366) has the molecular formula C19H30O2Si and a molecular weight of 318.53 g/mol. Its IUPAC name is tert-butyl-[[(2S,5R)-3,5-dimethyl-5-phenyl-2H-furan-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2S,5R)-3,5-dimethyl-5-phenyl-2H-furan-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134944366 |
| Molecular Formula | C19H30O2Si |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | tert-butyl-[[(2S,5R)-3,5-dimethyl-5-phenyl-2H-furan-2-yl]methoxy]-dimethylsilane |
| SMILES | CC1=C[C@](C)(c2ccccc2)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H30O2Si/c1-15-13-19(5,16-11-9-8-10-12-16)21-17(15)14-20-22(6,7)18(2,3)4/h8-13,17H,14H2,1-7H3/t17-,19-/m1/s1 |
| InChIKey | IPBIBLKYTCSGPL-IEBWSBKVSA-N |
| XLogP | 5.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|