C17H28O3Si — CID 140749012
tert-butyl-[[(4R)-2,2-dimethyl-4H-1,3-benzodioxin-4-yl]methoxy]-dimethylsilane (PubChem CID 140749012) has the molecular formula C17H28O3Si and a molecular weight of 308.49 g/mol. Its IUPAC name is tert-butyl-[[(4R)-2,2-dimethyl-4H-1,3-benzodioxin-4-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(4R)-2,2-dimethyl-4H-1,3-benzodioxin-4-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 140749012 |
| Molecular Formula | C17H28O3Si |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | tert-butyl-[[(4R)-2,2-dimethyl-4H-1,3-benzodioxin-4-yl]methoxy]-dimethylsilane |
| SMILES | CC1(C)Oc2ccccc2[C@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C17H28O3Si/c1-16(2,3)21(6,7)18-12-15-13-10-8-9-11-14(13)19-17(4,5)20-15/h8-11,15H,12H2,1-7H3/t15-/m0/s1 |
| InChIKey | AGBXKICFPLDRIA-HNNXBMFYSA-N |
| XLogP | 4.89 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|