C11H15NO5S — CID 134279582
[(4S)-2,2-dimethyl-4H-1,3-benzodioxin-4-yl]methylsulfamic acid (PubChem CID 134279582) has the molecular formula C11H15NO5S and a molecular weight of 273.31 g/mol. Its IUPAC name is [(4S)-2,2-dimethyl-4H-1,3-benzodioxin-4-yl]methylsulfamic acid.
| Compound Name | [(4S)-2,2-dimethyl-4H-1,3-benzodioxin-4-yl]methylsulfamic acid |
|---|---|
| PubChem CID | 134279582 |
| Molecular Formula | C11H15NO5S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | [(4S)-2,2-dimethyl-4H-1,3-benzodioxin-4-yl]methylsulfamic acid |
| SMILES | CC1(C)Oc2ccccc2[C@@H](CNS(=O)(=O)O)O1 |
| InChI | InChI=1S/C11H15NO5S/c1-11(2)16-9-6-4-3-5-8(9)10(17-11)7-12-18(13,14)15/h3-6,10,12H,7H2,1-2H3,(H,13,14,15)/t10-/m1/s1 |
| InChIKey | JQJYRHFWHPLLSX-SNVBAGLBSA-N |
| XLogP | 1.27 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|