C15H21NO5S — CID 134279612
2-spiro[4H-1,3-benzodioxine-2,1'-cyclohexane]-4-ylethylsulfamic acid (PubChem CID 134279612) has the molecular formula C15H21NO5S and a molecular weight of 327.40 g/mol. Its IUPAC name is 2-spiro[4H-1,3-benzodioxine-2,1'-cyclohexane]-4-ylethylsulfamic acid.
| Compound Name | 2-spiro[4H-1,3-benzodioxine-2,1'-cyclohexane]-4-ylethylsulfamic acid |
|---|---|
| PubChem CID | 134279612 |
| Molecular Formula | C15H21NO5S |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 2-spiro[4H-1,3-benzodioxine-2,1'-cyclohexane]-4-ylethylsulfamic acid |
| SMILES | O=S(=O)(O)NCCC1OC2(CCCCC2)Oc2ccccc21 |
| InChI | InChI=1S/C15H21NO5S/c17-22(18,19)16-11-8-14-12-6-2-3-7-13(12)20-15(21-14)9-4-1-5-10-15/h2-3,6-7,14,16H,1,4-5,8-11H2,(H,17,18,19) |
| InChIKey | QZFCYNYPPCMWFX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|