C16H23NO5S — CID 129068517
[3-(2-methylphenyl)-1,4-dioxaspiro[4.5]decan-2-yl]methylsulfamic acid (PubChem CID 129068517) has the molecular formula C16H23NO5S and a molecular weight of 341.43 g/mol. Its IUPAC name is [3-(2-methylphenyl)-1,4-dioxaspiro[4.5]decan-2-yl]methylsulfamic acid.
| Compound Name | [3-(2-methylphenyl)-1,4-dioxaspiro[4.5]decan-2-yl]methylsulfamic acid |
|---|---|
| PubChem CID | 129068517 |
| Molecular Formula | C16H23NO5S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | [3-(2-methylphenyl)-1,4-dioxaspiro[4.5]decan-2-yl]methylsulfamic acid |
| SMILES | Cc1ccccc1C1OC2(CCCCC2)OC1CNS(=O)(=O)O |
| InChI | InChI=1S/C16H23NO5S/c1-12-7-3-4-8-13(12)15-14(11-17-23(18,19)20)21-16(22-15)9-5-2-6-10-16/h3-4,7-8,14-15,17H,2,5-6,9-11H2,1H3,(H,18,19,20) |
| InChIKey | PQPIFGSLUSALGQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|