C35H38O2P2 — CID 170897994
[(2R,3R)-3-(diphenylphosphanylmethyl)-1,4-dioxaspiro[4.6]undecan-2-yl]methyl-diphenylphosphane (PubChem CID 170897994) has the molecular formula C35H38O2P2 and a molecular weight of 552.64 g/mol. Its IUPAC name is [(2R,3R)-3-(diphenylphosphanylmethyl)-1,4-dioxaspiro[4.6]undecan-2-yl]methyl-diphenylphosphane.
| Compound Name | [(2R,3R)-3-(diphenylphosphanylmethyl)-1,4-dioxaspiro[4.6]undecan-2-yl]methyl-diphenylphosphane |
|---|---|
| PubChem CID | 170897994 |
| Molecular Formula | C35H38O2P2 |
| Molecular Weight | 552.64 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | [(2R,3R)-3-(diphenylphosphanylmethyl)-1,4-dioxaspiro[4.6]undecan-2-yl]methyl-diphenylphosphane |
| SMILES | c1ccc(P(C[C@@H]2OC3(CCCCCC3)O[C@H]2CP(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C35H38O2P2/c1-2-16-26-35(25-15-1)36-33(27-38(29-17-7-3-8-18-29)30-19-9-4-10-20-30)34(37-35)28-39(31-21-11-5-12-22-31)32-23-13-6-14-24-32/h3-14,17-24,33-34H,1-2,15-16,25-28H2/t33-,34-/m0/s1 |
| InChIKey | RGOAOEOEOYNTCV-HEVIKAOCSA-N |
| XLogP | 7.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.64 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|