C36H34O3P2 — CID 11103808
[(4R,5R)-4,5-bis(diphenylphosphanylmethyl)-2-phenyl-1,3-dioxolan-2-yl]methanol (PubChem CID 11103808) has the molecular formula C36H34O3P2 and a molecular weight of 576.61 g/mol. Its IUPAC name is [(4R,5R)-4,5-bis(diphenylphosphanylmethyl)-2-phenyl-1,3-dioxolan-2-yl]methanol.
| Compound Name | [(4R,5R)-4,5-bis(diphenylphosphanylmethyl)-2-phenyl-1,3-dioxolan-2-yl]methanol |
|---|---|
| PubChem CID | 11103808 |
| Molecular Formula | C36H34O3P2 |
| Molecular Weight | 576.61 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | [(4R,5R)-4,5-bis(diphenylphosphanylmethyl)-2-phenyl-1,3-dioxolan-2-yl]methanol |
| SMILES | OCC1(c2ccccc2)O[C@@H](CP(c2ccccc2)c2ccccc2)[C@H](CP(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C36H34O3P2/c37-28-36(29-16-6-1-7-17-29)38-34(26-40(30-18-8-2-9-19-30)31-20-10-3-11-21-31)35(39-36)27-41(32-22-12-4-13-23-32)33-24-14-5-15-25-33/h1-25,34-35,37H,26-28H2/t34-,35-/m0/s1 |
| InChIKey | KPRDKGMOWFGESP-PXLJZGITSA-N |
| XLogP | 5.88 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.61 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|