C27H32NO3P — CID 15443434
N-[[(4S,5R)-5-(diphenylphosphanylmethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-methoxy-N-methylaniline (PubChem CID 15443434) has the molecular formula C27H32NO3P and a molecular weight of 449.53 g/mol. Its IUPAC name is N-[[(4S,5R)-5-(diphenylphosphanylmethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-methoxy-N-methylaniline.
| Compound Name | N-[[(4S,5R)-5-(diphenylphosphanylmethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-methoxy-N-methylaniline |
|---|---|
| PubChem CID | 15443434 |
| Molecular Formula | C27H32NO3P |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | N-[[(4S,5R)-5-(diphenylphosphanylmethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-methoxy-N-methylaniline |
| SMILES | COc1ccc(N(C)C[C@@H]2OC(C)(C)O[C@H]2CP(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H32NO3P/c1-27(2)30-25(19-28(3)21-15-17-22(29-4)18-16-21)26(31-27)20-32(23-11-7-5-8-12-23)24-13-9-6-10-14-24/h5-18,25-26H,19-20H2,1-4H3/t25-,26-/m0/s1 |
| InChIKey | RTWQYBMEZVFYEE-UIOOFZCWSA-N |
| XLogP | 4.78 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|