C24H36O2P2 — CID 142063841
ethane;[(5S)-5-(1-ethylphosphanylethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl-diphenylphosphane (PubChem CID 142063841) has the molecular formula C24H36O2P2 and a molecular weight of 418.50 g/mol. Its IUPAC name is ethane;[(5S)-5-(1-ethylphosphanylethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl-diphenylphosphane.
| Compound Name | ethane;[(5S)-5-(1-ethylphosphanylethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl-diphenylphosphane |
|---|---|
| PubChem CID | 142063841 |
| Molecular Formula | C24H36O2P2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | ethane;[(5S)-5-(1-ethylphosphanylethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl-diphenylphosphane |
| SMILES | CC.CCPC(C)[C@H]1OC(C)(C)OC1CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H30O2P2.C2H6/c1-5-25-17(2)21-20(23-22(3,4)24-21)16-26(18-12-8-6-9-13-18)19-14-10-7-11-15-19;1-2/h6-15,17,20-21,25H,5,16H2,1-4H3;1-2H3/t17?,20?,21-;/m1./s1 |
| InChIKey | LNXHNXKENZFHOV-VSBQDGLYSA-N |
| XLogP | 5.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|