C21H24N6O2 — CID 10763096
(4R,5R)-5-[(1S)-1-azido-2-phenylethyl]-4-[(1R)-1-azido-2-phenylethyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 10763096) has the molecular formula C21H24N6O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is (4R,5R)-5-[(1S)-1-azido-2-phenylethyl]-4-[(1R)-1-azido-2-phenylethyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R,5R)-5-[(1S)-1-azido-2-phenylethyl]-4-[(1R)-1-azido-2-phenylethyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 10763096 |
| Molecular Formula | C21H24N6O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | (4R,5R)-5-[(1S)-1-azido-2-phenylethyl]-4-[(1R)-1-azido-2-phenylethyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)O[C@H]([C@H](Cc2ccccc2)N=[N+]=[N-])[C@@H]([C@@H](Cc2ccccc2)N=[N+]=[N-])O1 |
| InChI | InChI=1S/C21H24N6O2/c1-21(2)28-19(17(24-26-22)13-15-9-5-3-6-10-15)20(29-21)18(25-27-23)14-16-11-7-4-8-12-16/h3-12,17-20H,13-14H2,1-2H3/t17-,18+,19-,20-/m1/s1 |
| InChIKey | IOSMZOXYFPTHLA-IYWMVGAKSA-N |
| XLogP | 5.35 |
| TPSA | 115.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|