About (2-azido-3,3-difluoropropyl)benzene
(2-azido-3,3-difluoropropyl)benzene (PubChem CID 151138482) has the molecular formula C9H9F2N3
and a molecular weight of 197.19 g/mol. Its IUPAC name is (2-azido-3,3-difluoropropyl)benzene.
Molecular Properties
| Compound Name | (2-azido-3,3-difluoropropyl)benzene |
| PubChem CID | 151138482 |
| Molecular Formula | C9H9F2N3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | (2-azido-3,3-difluoropropyl)benzene |
| SMILES | [N-]=[N+]=NC(Cc1ccccc1)C(F)F |
| InChI | InChI=1S/C9H9F2N3/c10-9(11)8(13-14-12)6-7-4-2-1-3-5-7/h1-5,8-9H,6H2 |
| InChIKey | MVRSANKRKTUXRZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (2-azido-3,3-difluoropropyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-azido-3,3-difluoropropyl)benzene?
The IUPAC name of (2-azido-3,3-difluoropropyl)benzene (CID 151138482) is (2-azido-3,3-difluoropropyl)benzene.
What is the SMILES notation for (2-azido-3,3-difluoropropyl)benzene?
The canonical SMILES for (2-azido-3,3-difluoropropyl)benzene is [N-]=[N+]=NC(Cc1ccccc1)C(F)F.
What is the InChIKey of (2-azido-3,3-difluoropropyl)benzene?
The InChIKey is MVRSANKRKTUXRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F2N3/c10-9(11)8(13-14-12)6-7-4-2-1-3-5-7/h1-5,8-9H,6H2.
What are the key properties of (2-azido-3,3-difluoropropyl)benzene?
(2-azido-3,3-difluoropropyl)benzene has a molecular weight of 197.19 g/mol, XLogP of 3.17, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-azido-3,3-difluoropropyl)benzene is sourced from PubChem (CID 151138482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).