C13H20N4O — CID 90871516
(2S,3R)-3-azido-1-phenyl-4-propoxybutan-2-amine (PubChem CID 90871516) has the molecular formula C13H20N4O and a molecular weight of 248.33 g/mol. Its IUPAC name is (2S,3R)-3-azido-1-phenyl-4-propoxybutan-2-amine.
| Compound Name | (2S,3R)-3-azido-1-phenyl-4-propoxybutan-2-amine |
|---|---|
| PubChem CID | 90871516 |
| Molecular Formula | C13H20N4O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | (2S,3R)-3-azido-1-phenyl-4-propoxybutan-2-amine |
| SMILES | CCCOC[C@H](N=[N+]=[N-])[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C13H20N4O/c1-2-8-18-10-13(16-17-15)12(14)9-11-6-4-3-5-7-11/h3-7,12-13H,2,8-10,14H2,1H3/t12-,13-/m0/s1 |
| InChIKey | BELYBTXNYPBBOC-STQMWFEESA-N |
| XLogP | 2.66 |
| TPSA | 84.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|