C13H21ClN4 — CID 140515436
(2S,3S)-3-azido-1-phenylheptan-2-amine;hydrochloride (PubChem CID 140515436) has the molecular formula C13H21ClN4 and a molecular weight of 268.79 g/mol. Its IUPAC name is (2S,3S)-3-azido-1-phenylheptan-2-amine;hydrochloride.
| Compound Name | (2S,3S)-3-azido-1-phenylheptan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 140515436 |
| Molecular Formula | C13H21ClN4 |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | (2S,3S)-3-azido-1-phenylheptan-2-amine;hydrochloride |
| SMILES | CCCC[C@H](N=[N+]=[N-])[C@@H](N)Cc1ccccc1.Cl |
| InChI | InChI=1S/C13H20N4.ClH/c1-2-3-9-13(16-17-15)12(14)10-11-7-5-4-6-8-11;/h4-8,12-13H,2-3,9-10,14H2,1H3;1H/t12-,13-;/m0./s1 |
| InChIKey | JHNSUJKZEFJSHK-QNTKWALQSA-N |
| XLogP | 3.85 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|