C14H20N4O — CID 102463984
(2R,3S)-3-azido-1-(but-3-enylamino)-4-phenylbutan-2-ol (PubChem CID 102463984) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is (2R,3S)-3-azido-1-(but-3-enylamino)-4-phenylbutan-2-ol.
| Compound Name | (2R,3S)-3-azido-1-(but-3-enylamino)-4-phenylbutan-2-ol |
|---|---|
| PubChem CID | 102463984 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | (2R,3S)-3-azido-1-(but-3-enylamino)-4-phenylbutan-2-ol |
| SMILES | C=CCCNC[C@@H](O)[C@H](Cc1ccccc1)N=[N+]=[N-] |
| InChI | InChI=1S/C14H20N4O/c1-2-3-9-16-11-14(19)13(17-18-15)10-12-7-5-4-6-8-12/h2,4-8,13-14,16,19H,1,3,9-11H2/t13-,14+/m0/s1 |
| InChIKey | DVDIQTAIAGMJHZ-UONOGXRCSA-N |
| XLogP | 2.43 |
| TPSA | 81.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|