C22H30BN2O2 — CID 59985054
CID 59985054 (PubChem CID 59985054) has the molecular formula C22H30BN2O2 and a molecular weight of 365.31 g/mol.
| Compound Name | CID 59985054 |
|---|---|
| PubChem CID | 59985054 |
| Molecular Formula | C22H30BN2O2 |
| Molecular Weight | 365.31 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | — |
| SMILES | CC(C)CNC[C@@H](O)[C@H](Cc1ccccc1)/N=C/O[B]Cc1ccccc1 |
| InChI | InChI=1S/C22H30BN2O2/c1-18(2)15-24-16-22(26)21(13-19-9-5-3-6-10-19)25-17-27-23-14-20-11-7-4-8-12-20/h3-12,17-18,21-22,24,26H,13-16H2,1-2H3/b25-17+/t21-,22+/m0/s1 |
| InChIKey | REIZIUXTSBCBBS-SBNMFCHZSA-N |
| XLogP | 3.07 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|