C15H21F3N4O — CID 102288817
(2R,3S)-3-azido-1-(2-methylpropylamino)-4-[3-(trifluoromethyl)phenyl]butan-2-ol (PubChem CID 102288817) has the molecular formula C15H21F3N4O and a molecular weight of 330.35 g/mol. Its IUPAC name is (2R,3S)-3-azido-1-(2-methylpropylamino)-4-[3-(trifluoromethyl)phenyl]butan-2-ol.
| Compound Name | (2R,3S)-3-azido-1-(2-methylpropylamino)-4-[3-(trifluoromethyl)phenyl]butan-2-ol |
|---|---|
| PubChem CID | 102288817 |
| Molecular Formula | C15H21F3N4O |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (2R,3S)-3-azido-1-(2-methylpropylamino)-4-[3-(trifluoromethyl)phenyl]butan-2-ol |
| SMILES | CC(C)CNC[C@@H](O)[C@H](Cc1cccc(C(F)(F)F)c1)N=[N+]=[N-] |
| InChI | InChI=1S/C15H21F3N4O/c1-10(2)8-20-9-14(23)13(21-22-19)7-11-4-3-5-12(6-11)15(16,17)18/h3-6,10,13-14,20,23H,7-9H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | RFLURGNAJJPPDM-UONOGXRCSA-N |
| XLogP | 3.53 |
| TPSA | 81.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|