C18H28ClN3O3 — CID 142112091
2-[(2-chloroacetyl)amino]-N-[3-hydroxy-4-(2-methylpropylamino)-1-phenylbutan-2-yl]acetamide (PubChem CID 142112091) has the molecular formula C18H28ClN3O3 and a molecular weight of 369.89 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)amino]-N-[3-hydroxy-4-(2-methylpropylamino)-1-phenylbutan-2-yl]acetamide.
| Compound Name | 2-[(2-chloroacetyl)amino]-N-[3-hydroxy-4-(2-methylpropylamino)-1-phenylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 142112091 |
| Molecular Formula | C18H28ClN3O3 |
| Molecular Weight | 369.89 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 2-[(2-chloroacetyl)amino]-N-[3-hydroxy-4-(2-methylpropylamino)-1-phenylbutan-2-yl]acetamide |
| SMILES | CC(C)CNCC(O)C(Cc1ccccc1)NC(=O)CNC(=O)CCl |
| InChI | InChI=1S/C18H28ClN3O3/c1-13(2)10-20-11-16(23)15(8-14-6-4-3-5-7-14)22-18(25)12-21-17(24)9-19/h3-7,13,15-16,20,23H,8-12H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | KBCOPAAONYSQRU-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.89 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|