C15H24N2O4 — CID 68608817
[(2S,3R)-3-hydroxy-4-(3-methoxypropylamino)-1-phenylbutan-2-yl]carbamic acid (PubChem CID 68608817) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is [(2S,3R)-3-hydroxy-4-(3-methoxypropylamino)-1-phenylbutan-2-yl]carbamic acid.
| Compound Name | [(2S,3R)-3-hydroxy-4-(3-methoxypropylamino)-1-phenylbutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 68608817 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | [(2S,3R)-3-hydroxy-4-(3-methoxypropylamino)-1-phenylbutan-2-yl]carbamic acid |
| SMILES | COCCCNC[C@@H](O)[C@H](Cc1ccccc1)NC(=O)O |
| InChI | InChI=1S/C15H24N2O4/c1-21-9-5-8-16-11-14(18)13(17-15(19)20)10-12-6-3-2-4-7-12/h2-4,6-7,13-14,16-18H,5,8-11H2,1H3,(H,19,20)/t13-,14+/m0/s1 |
| InChIKey | HSBRFCDLRLHCAR-UONOGXRCSA-N |
| XLogP | 0.85 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|