C20H26N2O4 — CID 69441907
[(2S,3R)-3-hydroxy-4-[2-(3-methoxyphenyl)ethylamino]-1-phenylbutan-2-yl]carbamic acid (PubChem CID 69441907) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is [(2S,3R)-3-hydroxy-4-[2-(3-methoxyphenyl)ethylamino]-1-phenylbutan-2-yl]carbamic acid.
| Compound Name | [(2S,3R)-3-hydroxy-4-[2-(3-methoxyphenyl)ethylamino]-1-phenylbutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 69441907 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | [(2S,3R)-3-hydroxy-4-[2-(3-methoxyphenyl)ethylamino]-1-phenylbutan-2-yl]carbamic acid |
| SMILES | COc1cccc(CCNC[C@@H](O)[C@H](Cc2ccccc2)NC(=O)O)c1 |
| InChI | InChI=1S/C20H26N2O4/c1-26-17-9-5-8-16(12-17)10-11-21-14-19(23)18(22-20(24)25)13-15-6-3-2-4-7-15/h2-9,12,18-19,21-23H,10-11,13-14H2,1H3,(H,24,25)/t18-,19+/m0/s1 |
| InChIKey | GVZTZSZFAHOLRL-RBUKOAKNSA-N |
| XLogP | 2.07 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|