C21H28N2O3 — CID 68608862
[(2S,3R)-3-hydroxy-1-phenyl-4-(4-phenylbutylamino)butan-2-yl]carbamic acid (PubChem CID 68608862) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is [(2S,3R)-3-hydroxy-1-phenyl-4-(4-phenylbutylamino)butan-2-yl]carbamic acid.
| Compound Name | [(2S,3R)-3-hydroxy-1-phenyl-4-(4-phenylbutylamino)butan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 68608862 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | [(2S,3R)-3-hydroxy-1-phenyl-4-(4-phenylbutylamino)butan-2-yl]carbamic acid |
| SMILES | O=C(O)N[C@@H](Cc1ccccc1)[C@H](O)CNCCCCc1ccccc1 |
| InChI | InChI=1S/C21H28N2O3/c24-20(16-22-14-8-7-11-17-9-3-1-4-10-17)19(23-21(25)26)15-18-12-5-2-6-13-18/h1-6,9-10,12-13,19-20,22-24H,7-8,11,14-16H2,(H,25,26)/t19-,20+/m0/s1 |
| InChIKey | VNPOGHUKSMMTHR-VQTJNVASSA-N |
| XLogP | 2.84 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|