C15H24N2O5 — CID 68611585
[(2S,3R)-3-hydroxy-4-[2-(2-hydroxyethoxy)ethylamino]-1-phenylbutan-2-yl]carbamic acid (PubChem CID 68611585) has the molecular formula C15H24N2O5 and a molecular weight of 312.37 g/mol. Its IUPAC name is [(2S,3R)-3-hydroxy-4-[2-(2-hydroxyethoxy)ethylamino]-1-phenylbutan-2-yl]carbamic acid.
| Compound Name | [(2S,3R)-3-hydroxy-4-[2-(2-hydroxyethoxy)ethylamino]-1-phenylbutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 68611585 |
| Molecular Formula | C15H24N2O5 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | [(2S,3R)-3-hydroxy-4-[2-(2-hydroxyethoxy)ethylamino]-1-phenylbutan-2-yl]carbamic acid |
| SMILES | O=C(O)N[C@@H](Cc1ccccc1)[C@H](O)CNCCOCCO |
| InChI | InChI=1S/C15H24N2O5/c18-7-9-22-8-6-16-11-14(19)13(17-15(20)21)10-12-4-2-1-3-5-12/h1-5,13-14,16-19H,6-11H2,(H,20,21)/t13-,14+/m0/s1 |
| InChIKey | ROHQOYLWOOLDSZ-UONOGXRCSA-N |
| XLogP | -0.18 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|