C17H26N2O3 — CID 66606024
[(2S,3R)-4-(hex-5-enylamino)-3-hydroxy-1-phenylbutan-2-yl]carbamic acid (PubChem CID 66606024) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is [(2S,3R)-4-(hex-5-enylamino)-3-hydroxy-1-phenylbutan-2-yl]carbamic acid.
| Compound Name | [(2S,3R)-4-(hex-5-enylamino)-3-hydroxy-1-phenylbutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 66606024 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | [(2S,3R)-4-(hex-5-enylamino)-3-hydroxy-1-phenylbutan-2-yl]carbamic acid |
| SMILES | C=CCCCCNC[C@@H](O)[C@H](Cc1ccccc1)NC(=O)O |
| InChI | InChI=1S/C17H26N2O3/c1-2-3-4-8-11-18-13-16(20)15(19-17(21)22)12-14-9-6-5-7-10-14/h2,5-7,9-10,15-16,18-20H,1,3-4,8,11-13H2,(H,21,22)/t15-,16+/m0/s1 |
| InChIKey | NPOLKSXBFDGDDI-JKSUJKDBSA-N |
| XLogP | 2.17 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|