C21H28N2O3 — CID 138631491
[[(2S,3R)-3-hydroxy-4-(2-methylpropylamino)-1-phenylbutan-2-yl]amino] benzoate (PubChem CID 138631491) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is [[(2S,3R)-3-hydroxy-4-(2-methylpropylamino)-1-phenylbutan-2-yl]amino] benzoate.
| Compound Name | [[(2S,3R)-3-hydroxy-4-(2-methylpropylamino)-1-phenylbutan-2-yl]amino] benzoate |
|---|---|
| PubChem CID | 138631491 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | [[(2S,3R)-3-hydroxy-4-(2-methylpropylamino)-1-phenylbutan-2-yl]amino] benzoate |
| SMILES | CC(C)CNC[C@@H](O)[C@H](Cc1ccccc1)NOC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H28N2O3/c1-16(2)14-22-15-20(24)19(13-17-9-5-3-6-10-17)23-26-21(25)18-11-7-4-8-12-18/h3-12,16,19-20,22-24H,13-15H2,1-2H3/t19-,20+/m0/s1 |
| InChIKey | KEIUUPFCAUYSDL-VQTJNVASSA-N |
| XLogP | 2.57 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|