C28H29N3O5 — CID 10994557
(3aR,5R,6S,6aR)-5-[(1S)-1-azido-2-trityloxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol (PubChem CID 10994557) has the molecular formula C28H29N3O5 and a molecular weight of 487.56 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-5-[(1S)-1-azido-2-trityloxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol.
| Compound Name | (3aR,5R,6S,6aR)-5-[(1S)-1-azido-2-trityloxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 10994557 |
| Molecular Formula | C28H29N3O5 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | (3aR,5R,6S,6aR)-5-[(1S)-1-azido-2-trityloxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)N=[N+]=[N-])[C@H](O)[C@H]2O1 |
| InChI | InChI=1S/C28H29N3O5/c1-27(2)35-25-23(32)24(34-26(25)36-27)22(30-31-29)18-33-28(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-17,22-26,32H,18H2,1-2H3/t22-,23-,24+,25+,26+/m0/s1 |
| InChIKey | FCHSYWCHPREWJK-FZPKUJNRSA-N |
| XLogP | 4.91 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|