C42H42N2O6 — CID 102319576
1-[(1R)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-trityloxyethyl]-3-phenylurea (PubChem CID 102319576) has the molecular formula C42H42N2O6 and a molecular weight of 670.81 g/mol. Its IUPAC name is 1-[(1R)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-trityloxyethyl]-3-phenylurea.
| Compound Name | 1-[(1R)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-trityloxyethyl]-3-phenylurea |
|---|---|
| PubChem CID | 102319576 |
| Molecular Formula | C42H42N2O6 |
| Molecular Weight | 670.81 g/mol |
| Exact Mass | 670.30 |
| IUPAC Name | 1-[(1R)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-trityloxyethyl]-3-phenylurea |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)NC(=O)Nc3ccccc3)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C42H42N2O6/c1-41(2)49-38-37(46-28-30-18-8-3-9-19-30)36(48-39(38)50-41)35(44-40(45)43-34-26-16-7-17-27-34)29-47-42(31-20-10-4-11-21-31,32-22-12-5-13-23-32)33-24-14-6-15-25-33/h3-27,35-39H,28-29H2,1-2H3,(H2,43,44,45)/t35-,36-,37+,38-,39-/m1/s1 |
| InChIKey | UKUCYSXTZIDMPV-GFRPZHATSA-N |
| XLogP | 7.65 |
| TPSA | 87.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.81 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|