C19H29O8PS — CID 11744381
[(1S)-1-[(3aR,5S,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-trimethylphosphaniumylethyl] sulfate (PubChem CID 11744381) has the molecular formula C19H29O8PS and a molecular weight of 448.47 g/mol. Its IUPAC name is [(1S)-1-[(3aR,5S,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-trimethylphosphaniumylethyl] sulfate.
| Compound Name | [(1S)-1-[(3aR,5S,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-trimethylphosphaniumylethyl] sulfate |
|---|---|
| PubChem CID | 11744381 |
| Molecular Formula | C19H29O8PS |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | [(1S)-1-[(3aR,5S,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-trimethylphosphaniumylethyl] sulfate |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@@H](C[P+](C)(C)C)OS(=O)(=O)[O-])[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C19H29O8PS/c1-19(2)25-17-16(23-11-13-9-7-6-8-10-13)15(24-18(17)26-19)14(12-28(3,4)5)27-29(20,21)22/h6-10,14-18H,11-12H2,1-5H3/t14-,15-,16+,17-,18-/m1/s1 |
| InChIKey | RYJXEJINVJCPNG-UYTYNIKBSA-N |
| XLogP | 2.20 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|