C16H21NO7 — CID 11602517
(1R)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-nitroethanol (PubChem CID 11602517) has the molecular formula C16H21NO7 and a molecular weight of 339.34 g/mol. Its IUPAC name is (1R)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-nitroethanol.
| Compound Name | (1R)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-nitroethanol |
|---|---|
| PubChem CID | 11602517 |
| Molecular Formula | C16H21NO7 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | (1R)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-nitroethanol |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H](O)C[N+](=O)[O-])[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C16H21NO7/c1-16(2)23-14-13(21-9-10-6-4-3-5-7-10)12(22-15(14)24-16)11(18)8-17(19)20/h3-7,11-15,18H,8-9H2,1-2H3/t11-,12-,13+,14-,15-/m1/s1 |
| InChIKey | ASCZPQFSJKWFJM-UXXRCYHCSA-N |
| XLogP | 1.09 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|