C32H34O8 — CID 22696391
[(3aR,5R,6S,6aR)-5-(1-acetyloxy-2-trityloxyethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate (PubChem CID 22696391) has the molecular formula C32H34O8 and a molecular weight of 546.62 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-5-(1-acetyloxy-2-trityloxyethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate.
| Compound Name | [(3aR,5R,6S,6aR)-5-(1-acetyloxy-2-trityloxyethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate |
|---|---|
| PubChem CID | 22696391 |
| Molecular Formula | C32H34O8 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | [(3aR,5R,6S,6aR)-5-(1-acetyloxy-2-trityloxyethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate |
| SMILES | CC(=O)OC(COC(c1ccccc1)(c1ccccc1)c1ccccc1)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OC(C)=O |
| InChI | InChI=1S/C32H34O8/c1-21(33)36-26(27-28(37-22(2)34)29-30(38-27)40-31(3,4)39-29)20-35-32(23-14-8-5-9-15-23,24-16-10-6-11-17-24)25-18-12-7-13-19-25/h5-19,26-30H,20H2,1-4H3/t26?,27-,28+,29-,30-/m1/s1 |
| InChIKey | WGCVJNPEVHKYOG-ZKJZDWLCSA-N |
| XLogP | 4.73 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|