C15H23NO9 — CID 122699293
[(2R)-2-[(3aR,5R,6R,6aR)-6-acetamidooxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-acetyloxyethyl] acetate (PubChem CID 122699293) has the molecular formula C15H23NO9 and a molecular weight of 361.35 g/mol. Its IUPAC name is [(2R)-2-[(3aR,5R,6R,6aR)-6-acetamidooxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-acetyloxyethyl] acetate.
| Compound Name | [(2R)-2-[(3aR,5R,6R,6aR)-6-acetamidooxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-acetyloxyethyl] acetate |
|---|---|
| PubChem CID | 122699293 |
| Molecular Formula | C15H23NO9 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | [(2R)-2-[(3aR,5R,6R,6aR)-6-acetamidooxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-acetyloxyethyl] acetate |
| SMILES | CC(=O)NO[C@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C15H23NO9/c1-7(17)16-25-12-11(10(21-9(3)19)6-20-8(2)18)22-14-13(12)23-15(4,5)24-14/h10-14H,6H2,1-5H3,(H,16,17)/t10-,11-,12-,13-,14-/m1/s1 |
| InChIKey | FFRFNUJUIBNALJ-DHGKCCLASA-N |
| XLogP | -0.21 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|