C15H22O9 — CID 23659756
[(2S)-2-[(3aS,4R,6R,6aS)-4-acetyloxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-acetyloxyethyl] acetate (PubChem CID 23659756) has the molecular formula C15H22O9 and a molecular weight of 346.33 g/mol. Its IUPAC name is [(2S)-2-[(3aS,4R,6R,6aS)-4-acetyloxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-acetyloxyethyl] acetate.
| Compound Name | [(2S)-2-[(3aS,4R,6R,6aS)-4-acetyloxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-acetyloxyethyl] acetate |
|---|---|
| PubChem CID | 23659756 |
| Molecular Formula | C15H22O9 |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | [(2S)-2-[(3aS,4R,6R,6aS)-4-acetyloxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-acetyloxyethyl] acetate |
| SMILES | CC(=O)OC[C@H](OC(C)=O)[C@H]1O[C@H](OC(C)=O)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C15H22O9/c1-7(16)19-6-10(20-8(2)17)11-12-13(24-15(4,5)23-12)14(22-11)21-9(3)18/h10-14H,6H2,1-5H3/t10-,11+,12-,13-,14-/m0/s1 |
| InChIKey | NOSVZZKGBHQYOJ-NDKCEZKHSA-N |
| XLogP | 0.29 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|