C13H20O13S2 — CID 122398481
[(2R)-2-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-sulfooxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-sulfooxyethyl] 2-methylprop-2-enoate (PubChem CID 122398481) has the molecular formula C13H20O13S2 and a molecular weight of 448.42 g/mol. Its IUPAC name is [(2R)-2-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-sulfooxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-sulfooxyethyl] 2-methylprop-2-enoate.
| Compound Name | [(2R)-2-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-sulfooxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-sulfooxyethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 122398481 |
| Molecular Formula | C13H20O13S2 |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.03 |
| IUPAC Name | [(2R)-2-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-sulfooxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-sulfooxyethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC[C@@H](OS(=O)(=O)O)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OS(=O)(=O)O |
| InChI | InChI=1S/C13H20O13S2/c1-6(2)11(14)21-5-7(25-27(15,16)17)8-9(26-28(18,19)20)10-12(22-8)24-13(3,4)23-10/h7-10,12H,1,5H2,2-4H3,(H,15,16,17)(H,18,19,20)/t7-,8-,9+,10-,12-/m1/s1 |
| InChIKey | ZGDLRGISYUMVQR-WSOSLHDDSA-N |
| XLogP | -0.64 |
| TPSA | 181.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|