C14H19NO7S — CID 101221240
[(2R)-2-[(3aR,5R,6S,6aR)-6-acetyloxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-isothiocyanatoethyl] acetate (PubChem CID 101221240) has the molecular formula C14H19NO7S and a molecular weight of 345.37 g/mol. Its IUPAC name is [(2R)-2-[(3aR,5R,6S,6aR)-6-acetyloxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-isothiocyanatoethyl] acetate.
| Compound Name | [(2R)-2-[(3aR,5R,6S,6aR)-6-acetyloxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-isothiocyanatoethyl] acetate |
|---|---|
| PubChem CID | 101221240 |
| Molecular Formula | C14H19NO7S |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | [(2R)-2-[(3aR,5R,6S,6aR)-6-acetyloxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-isothiocyanatoethyl] acetate |
| SMILES | CC(=O)OC[C@@H](N=C=S)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OC(C)=O |
| InChI | InChI=1S/C14H19NO7S/c1-7(16)18-5-9(15-6-23)10-11(19-8(2)17)12-13(20-10)22-14(3,4)21-12/h9-13H,5H2,1-4H3/t9-,10-,11+,12-,13-/m1/s1 |
| InChIKey | PXPYCKPCRPNTSG-UJPOAAIJSA-N |
| XLogP | 0.83 |
| TPSA | 92.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|