C11H15BrO6 — CID 51032932
[(3aR,5S,6R,6aR)-5-(2-bromoacetyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate (PubChem CID 51032932) has the molecular formula C11H15BrO6 and a molecular weight of 323.14 g/mol. Its IUPAC name is [(3aR,5S,6R,6aR)-5-(2-bromoacetyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate.
| Compound Name | [(3aR,5S,6R,6aR)-5-(2-bromoacetyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate |
|---|---|
| PubChem CID | 51032932 |
| Molecular Formula | C11H15BrO6 |
| Molecular Weight | 323.14 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | [(3aR,5S,6R,6aR)-5-(2-bromoacetyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1C(=O)CBr |
| InChI | InChI=1S/C11H15BrO6/c1-5(13)15-8-7(6(14)4-12)16-10-9(8)17-11(2,3)18-10/h7-10H,4H2,1-3H3/t7-,8+,9-,10-/m1/s1 |
| InChIKey | ZGFAVOXPZPWZFK-UTINFBMNSA-N |
| XLogP | 0.76 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.14 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|