C15H24O7 — CID 44573194
[(1R,2S,6S,7S,8R,9R)-8-methoxy-4,4,11,11-tetramethyl-3,5,10,12-tetraoxatricyclo[7.3.0.02,6]dodecan-7-yl] acetate (PubChem CID 44573194) has the molecular formula C15H24O7 and a molecular weight of 316.35 g/mol. Its IUPAC name is [(1R,2S,6S,7S,8R,9R)-8-methoxy-4,4,11,11-tetramethyl-3,5,10,12-tetraoxatricyclo[7.3.0.02,6]dodecan-7-yl] acetate.
| Compound Name | [(1R,2S,6S,7S,8R,9R)-8-methoxy-4,4,11,11-tetramethyl-3,5,10,12-tetraoxatricyclo[7.3.0.02,6]dodecan-7-yl] acetate |
|---|---|
| PubChem CID | 44573194 |
| Molecular Formula | C15H24O7 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | [(1R,2S,6S,7S,8R,9R)-8-methoxy-4,4,11,11-tetramethyl-3,5,10,12-tetraoxatricyclo[7.3.0.02,6]dodecan-7-yl] acetate |
| SMILES | CO[C@H]1[C@H](OC(C)=O)[C@H]2OC(C)(C)O[C@H]2[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C15H24O7/c1-7(16)18-9-8(17-6)10-12(21-14(2,3)19-10)13-11(9)20-15(4,5)22-13/h8-13H,1-6H3/t8-,9-,10+,11+,12+,13+/m0/s1 |
| InChIKey | KYNXIOQZEVGFSF-LSUSWQKBSA-N |
| XLogP | 0.99 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |