C12H21NO6 — CID 135018449
[(4R,7R,7aS)-6-(aminomethyl)-4-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate (PubChem CID 135018449) has the molecular formula C12H21NO6 and a molecular weight of 275.30 g/mol. Its IUPAC name is [(4R,7R,7aS)-6-(aminomethyl)-4-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate.
| Compound Name | [(4R,7R,7aS)-6-(aminomethyl)-4-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate |
|---|---|
| PubChem CID | 135018449 |
| Molecular Formula | C12H21NO6 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | [(4R,7R,7aS)-6-(aminomethyl)-4-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate |
| SMILES | CO[C@@H]1OC(CN)[C@@H](OC(C)=O)[C@@H]2OC(C)(C)OC12 |
| InChI | InChI=1S/C12H21NO6/c1-6(14)16-8-7(5-13)17-11(15-4)10-9(8)18-12(2,3)19-10/h7-11H,5,13H2,1-4H3/t7?,8-,9+,10?,11-/m1/s1 |
| InChIKey | GBZJAUUPEHRSKT-ACWRHBLHSA-N |
| XLogP | -0.23 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |