C17H24O10 — CID 45050308
[(7R)-5,6,7-triacetyloxy-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl] acetate (PubChem CID 45050308) has the molecular formula C17H24O10 and a molecular weight of 388.37 g/mol. Its IUPAC name is [(7R)-5,6,7-triacetyloxy-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl] acetate.
| Compound Name | [(7R)-5,6,7-triacetyloxy-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl] acetate |
|---|---|
| PubChem CID | 45050308 |
| Molecular Formula | C17H24O10 |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | [(7R)-5,6,7-triacetyloxy-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl] acetate |
| SMILES | CC(=O)OC1C(OC(C)=O)C(OC(C)=O)[C@H](OC(C)=O)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C17H24O10/c1-7(18)22-11-12(23-8(2)19)14(25-10(4)21)16-15(13(11)24-9(3)20)26-17(5,6)27-16/h11-16H,1-6H3/t11?,12?,13-,14?,15?,16?/m0/s1 |
| InChIKey | XSWHBVWGSAGKTQ-OUCUAENXSA-N |
| XLogP | 0.25 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|