C13H20O5 — CID 10422539
[(1S,2R,6R,8S,9R,11S)-4,4,11-trimethyl-3,5,7-trioxatricyclo[6.3.0.02,6]undecan-9-yl] acetate (PubChem CID 10422539) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is [(1S,2R,6R,8S,9R,11S)-4,4,11-trimethyl-3,5,7-trioxatricyclo[6.3.0.02,6]undecan-9-yl] acetate.
| Compound Name | [(1S,2R,6R,8S,9R,11S)-4,4,11-trimethyl-3,5,7-trioxatricyclo[6.3.0.02,6]undecan-9-yl] acetate |
|---|---|
| PubChem CID | 10422539 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | [(1S,2R,6R,8S,9R,11S)-4,4,11-trimethyl-3,5,7-trioxatricyclo[6.3.0.02,6]undecan-9-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@H](C)[C@@H]2[C@H]3OC(C)(C)O[C@H]3O[C@@H]21 |
| InChI | InChI=1S/C13H20O5/c1-6-5-8(15-7(2)14)10-9(6)11-12(16-10)18-13(3,4)17-11/h6,8-12H,5H2,1-4H3/t6-,8+,9-,10+,11+,12+/m0/s1 |
| InChIKey | NNSBMTCWNMSEPN-OIDNESDHSA-N |
| XLogP | 1.45 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |