C12H20O6S — CID 87390652
[(4aS,7R,8S,8aR)-8-methoxy-2,2-dimethyl-6-sulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate (PubChem CID 87390652) has the molecular formula C12H20O6S and a molecular weight of 292.35 g/mol. Its IUPAC name is [(4aS,7R,8S,8aR)-8-methoxy-2,2-dimethyl-6-sulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate.
| Compound Name | [(4aS,7R,8S,8aR)-8-methoxy-2,2-dimethyl-6-sulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate |
|---|---|
| PubChem CID | 87390652 |
| Molecular Formula | C12H20O6S |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | [(4aS,7R,8S,8aR)-8-methoxy-2,2-dimethyl-6-sulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate |
| SMILES | CO[C@H]1[C@@H]2OC(C)(C)OC[C@@H]2OC(S)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C12H20O6S/c1-6(13)16-10-9(14-4)8-7(17-11(10)19)5-15-12(2,3)18-8/h7-11,19H,5H2,1-4H3/t7-,8+,9-,10+,11?/m0/s1 |
| InChIKey | BYGKUZPNFCNXJC-NLSOGMSDSA-N |
| XLogP | 0.74 |
| TPSA | 63.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|