C12H22O5S — CID 71158680
(6S,8S,8aR)-6-ethylsulfanyl-8-methoxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol (PubChem CID 71158680) has the molecular formula C12H22O5S and a molecular weight of 278.37 g/mol. Its IUPAC name is (6S,8S,8aR)-6-ethylsulfanyl-8-methoxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol.
| Compound Name | (6S,8S,8aR)-6-ethylsulfanyl-8-methoxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
|---|---|
| PubChem CID | 71158680 |
| Molecular Formula | C12H22O5S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (6S,8S,8aR)-6-ethylsulfanyl-8-methoxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
| SMILES | CCS[C@@H]1OC2COC(C)(C)O[C@H]2[C@@H](OC)C1O |
| InChI | InChI=1S/C12H22O5S/c1-5-18-11-8(13)10(14-4)9-7(16-11)6-15-12(2,3)17-9/h7-11,13H,5-6H2,1-4H3/t7?,8?,9-,10+,11+/m1/s1 |
| InChIKey | ZFVDOADCTKTKAT-QIBXXNMASA-N |
| XLogP | 0.99 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |