C12H22O6 — CID 174939901
(4aR,6R,7R,8R,8aS)-2,2-dimethyl-6-propoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol (PubChem CID 174939901) has the molecular formula C12H22O6 and a molecular weight of 262.30 g/mol. Its IUPAC name is (4aR,6R,7R,8R,8aS)-2,2-dimethyl-6-propoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol.
| Compound Name | (4aR,6R,7R,8R,8aS)-2,2-dimethyl-6-propoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
|---|---|
| PubChem CID | 174939901 |
| Molecular Formula | C12H22O6 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | (4aR,6R,7R,8R,8aS)-2,2-dimethyl-6-propoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
| SMILES | CCCO[C@@H]1O[C@@H]2COC(C)(C)O[C@H]2[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H22O6/c1-4-5-15-11-9(14)8(13)10-7(17-11)6-16-12(2,3)18-10/h7-11,13-14H,4-6H2,1-3H3/t7-,8-,9-,10-,11-/m1/s1 |
| InChIKey | JWSIPLBHGABRDJ-ISUQUUIWSA-N |
| XLogP | 0.01 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |