C14H24O7 — CID 101335184
2-[[(1R,2S,6S,7S,9R)-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-7-yl]oxy]ethanol (PubChem CID 101335184) has the molecular formula C14H24O7 and a molecular weight of 304.34 g/mol. Its IUPAC name is 2-[[(1R,2S,6S,7S,9R)-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-7-yl]oxy]ethanol.
| Compound Name | 2-[[(1R,2S,6S,7S,9R)-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-7-yl]oxy]ethanol |
|---|---|
| PubChem CID | 101335184 |
| Molecular Formula | C14H24O7 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 2-[[(1R,2S,6S,7S,9R)-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-7-yl]oxy]ethanol |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](OCCO)O[C@@H]1COC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C14H24O7/c1-13(2)17-7-8-9(19-13)10-11(21-14(3,4)20-10)12(18-8)16-6-5-15/h8-12,15H,5-7H2,1-4H3/t8-,9-,10+,11+,12+/m1/s1 |
| InChIKey | DMKTXUAPFPYNMX-GCHJQGSQSA-N |
| XLogP | 0.39 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |