C28H46O14 — CID 11192762
(2S,3S)-1,4-bis[[(1R,2S,6S,7S,9R)-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-7-yl]oxy]butane-2,3-diol (PubChem CID 11192762) has the molecular formula C28H46O14 and a molecular weight of 606.66 g/mol. Its IUPAC name is (2S,3S)-1,4-bis[[(1R,2S,6S,7S,9R)-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-7-yl]oxy]butane-2,3-diol.
| Compound Name | (2S,3S)-1,4-bis[[(1R,2S,6S,7S,9R)-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-7-yl]oxy]butane-2,3-diol |
|---|---|
| PubChem CID | 11192762 |
| Molecular Formula | C28H46O14 |
| Molecular Weight | 606.66 g/mol |
| Exact Mass | 606.29 |
| IUPAC Name | (2S,3S)-1,4-bis[[(1R,2S,6S,7S,9R)-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-7-yl]oxy]butane-2,3-diol |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](OC[C@H](O)[C@@H](O)CO[C@H]1O[C@@H]3COC(C)(C)O[C@H]3[C@@H]3OC(C)(C)O[C@H]13)O[C@@H]1COC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C28H46O14/c1-25(2)33-11-15-17(37-25)19-21(41-27(5,6)39-19)23(35-15)31-9-13(29)14(30)10-32-24-22-20(40-28(7,8)42-22)18-16(36-24)12-34-26(3,4)38-18/h13-24,29-30H,9-12H2,1-8H3/t13-,14-,15+,16+,17+,18+,19-,20-,21-,22-,23-,24-/m0/s1 |
| InChIKey | IWNCALGVUGJEEI-NYMCBMKKSA-N |
| XLogP | 0.53 |
| TPSA | 151.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.66 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |