C12H19ClO5 — CID 11808046
(1R,2S,6S,7R,9R)-7-chloro-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane (PubChem CID 11808046) has the molecular formula C12H19ClO5 and a molecular weight of 278.73 g/mol. Its IUPAC name is (1R,2S,6S,7R,9R)-7-chloro-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane.
| Compound Name | (1R,2S,6S,7R,9R)-7-chloro-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane |
|---|---|
| PubChem CID | 11808046 |
| Molecular Formula | C12H19ClO5 |
| Molecular Weight | 278.73 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | (1R,2S,6S,7R,9R)-7-chloro-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](Cl)O[C@@H]1COC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C12H19ClO5/c1-11(2)14-5-6-7(16-11)8-9(10(13)15-6)18-12(3,4)17-8/h6-10H,5H2,1-4H3/t6-,7-,8+,9+,10+/m1/s1 |
| InChIKey | WVLGVSWRMBXODG-ZJDVBMNYSA-N |
| XLogP | 1.62 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.73 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|