C14H24O6 — CID 71169382
(1R,6R)-8-methoxy-4,4,13,13-tetramethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecane (PubChem CID 71169382) has the molecular formula C14H24O6 and a molecular weight of 288.34 g/mol. Its IUPAC name is (1R,6R)-8-methoxy-4,4,13,13-tetramethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecane.
| Compound Name | (1R,6R)-8-methoxy-4,4,13,13-tetramethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecane |
|---|---|
| PubChem CID | 71169382 |
| Molecular Formula | C14H24O6 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | (1R,6R)-8-methoxy-4,4,13,13-tetramethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecane |
| SMILES | COC1C[C@H]2OC(C)(C)OC2[C@@H]2OC(C)(C)OCC2O1 |
| InChI | InChI=1S/C14H24O6/c1-13(2)16-7-9-12(19-13)11-8(6-10(15-5)17-9)18-14(3,4)20-11/h8-12H,6-7H2,1-5H3/t8-,9?,10?,11?,12-/m1/s1 |
| InChIKey | ZIBRIFFYGPNZRQ-OQIXZIGXSA-N |
| XLogP | 1.42 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |