C8H13ClO3 — CID 101076376
(3aR,4S,6R,6aR)-4-chloro-2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole (PubChem CID 101076376) has the molecular formula C8H13ClO3 and a molecular weight of 192.64 g/mol. Its IUPAC name is (3aR,4S,6R,6aR)-4-chloro-2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole.
| Compound Name | (3aR,4S,6R,6aR)-4-chloro-2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 101076376 |
| Molecular Formula | C8H13ClO3 |
| Molecular Weight | 192.64 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | (3aR,4S,6R,6aR)-4-chloro-2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
| SMILES | C[C@H]1O[C@@H](Cl)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C8H13ClO3/c1-4-5-6(7(9)10-4)12-8(2,3)11-5/h4-7H,1-3H3/t4-,5-,6-,7-/m1/s1 |
| InChIKey | FIFLTGVPWDDVHG-DBRKOABJSA-N |
| XLogP | 1.49 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.64 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|