C16H28O5 — CID 101023569
(1R,2R,6R,7S,9R,10R)-4,4,7,12,12-pentamethyl-10-propan-2-yl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane (PubChem CID 101023569) has the molecular formula C16H28O5 and a molecular weight of 300.40 g/mol. Its IUPAC name is (1R,2R,6R,7S,9R,10R)-4,4,7,12,12-pentamethyl-10-propan-2-yl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane.
| Compound Name | (1R,2R,6R,7S,9R,10R)-4,4,7,12,12-pentamethyl-10-propan-2-yl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane |
|---|---|
| PubChem CID | 101023569 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | (1R,2R,6R,7S,9R,10R)-4,4,7,12,12-pentamethyl-10-propan-2-yl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane |
| SMILES | CC(C)[C@H]1OC(C)(C)O[C@H]2[C@@H]3OC(C)(C)O[C@@H]3[C@H](C)O[C@@H]21 |
| InChI | InChI=1S/C16H28O5/c1-8(2)10-12-14(21-15(4,5)18-10)13-11(9(3)17-12)19-16(6,7)20-13/h8-14H,1-7H3/t9-,10+,11+,12+,13+,14+/m0/s1 |
| InChIKey | LHILEAYVVCIFKZ-YHBOFVJASA-N |
| XLogP | 2.47 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |