C9H16O6S — CID 10824692
(3aS,4S,8S,8aS)-2,2,4,8-tetramethyl-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3,2]dioxathiepine 6,6-dioxide (PubChem CID 10824692) has the molecular formula C9H16O6S and a molecular weight of 252.29 g/mol. Its IUPAC name is (3aS,4S,8S,8aS)-2,2,4,8-tetramethyl-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3,2]dioxathiepine 6,6-dioxide.
| Compound Name | (3aS,4S,8S,8aS)-2,2,4,8-tetramethyl-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3,2]dioxathiepine 6,6-dioxide |
|---|---|
| PubChem CID | 10824692 |
| Molecular Formula | C9H16O6S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | (3aS,4S,8S,8aS)-2,2,4,8-tetramethyl-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3,2]dioxathiepine 6,6-dioxide |
| SMILES | C[C@@H]1OS(=O)(=O)O[C@@H](C)[C@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C9H16O6S/c1-5-7-8(13-9(3,4)12-7)6(2)15-16(10,11)14-5/h5-8H,1-4H3/t5-,6-,7+,8+/m0/s1 |
| InChIKey | JIZDKVYAAPLVKT-RULNZFCNSA-N |
| XLogP | 0.58 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |